akeareacates akeareacates

01-12-2018
History

contestada

What political effects did literacy tests and poll taxes have in the “New South” after Reconstruction?

Respuesta :

themrsomo7 themrsomo7

02-12-2018

It kept both poor whites and blacks from voting. Poor people did not have the time and money to get an education. And the tax for dirt farmers were about what they spent in a month. So only middle class and up voted.

Answer Link

Otras preguntas

Which statement describes the purpose of the Freedom Charter? A. to replace the existing constitution B. to state core beliefs and demand rights C. to announce

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

what is the work and answer for this question 3x-8y=2 y=-3x+20

Why SHOULD teacher have guns in school? (Explain in at least 4 sentences)

Calculate the number of grams of oxygen present in 1.75 moles of calcium carbonate

What is the median of the data set 10, 7, 9, 9, 4, 6?

Observing the temporal bone and locates the jugular foramen and the jugular fossa. what two types of bone markings has she identified?

is the answer a, b, c, or d.

What are elements of plot structure that the reader can study in order to understand the resolution

Which will bet help Markus understand the central ideas as he reads