3252567ooo 3252567ooo

01-04-2020
Health

contestada

Question: How do the traits of offspring plants relate to the traits of parent plants?

Respuesta :

paceevers paceevers

09-04-2020

Answer: The inherited traits will be the same

Explanation:

Answer Link

Otras preguntas

Prompt José de Espronceda José de Espronceda (1808-1842) vivió en España y es considerado uno de los poetas más famosos del período literario del Romanticismo.

Describe how effective employee relations techniques prevent the need for unionization.

In a secondary school class, 23 students study Economics, 6 students study both government and economics. 48 students study either government or Economics or bo

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

A scientist discovers an unknown multicellular organism that filters microorganisms from its marine habitat for food and reproduces sexually. Which kingdom does

Why do the lighter isotopes disappear first from the atmosphere? Where do those isotopes go?

if 1+sin² =3sin *cos, prove that tan = 1 or 1/2

The risk free measure for the risk-free rate should be ______ the risk-free rate used for the market risk premium

help pleaseeeee tysm

What structure in the male reproductive system produces most of the seminal fluid?